Drug Information| Drug ID: | NPD8832 |
| Drug Name: | Tisopurine |
| Molecular Formula: | C5H4N4S |
| Canonical SMILES: | Sc1ncnc2c1c[nH]n2 |
| Standard InCHI: | InChI=1S/C5H4N4S/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10) |
| Standard InCHIKey: | PYAOPMWCFSVFOT-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8832Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8045 | NPC321929 |
| Remote Similarity | 0.697 | NPC189314 |
| Remote Similarity | 0.6716 | NPC68938 |
| Remote Similarity | 0.6589 | NPC222061 |
| Remote Similarity | 0.626 | NPC18335 |
| Remote Similarity | 0.622 | NPC476128 |
| Remote Similarity | 0.6048 | NPC326364 |
| Remote Similarity | 0.6037 | NPC321393 |
| Remote Similarity | 0.6031 | NPC87981 |
| Remote Similarity | 0.6031 | NPC174114 |
| Remote Similarity | 0.5912 | NPC4837 |
| Remote Similarity | 0.5912 | NPC312187 |
| Remote Similarity | 0.5762 | NPC57279 |
| Remote Similarity | 0.5735 | NPC163105 |
| Remote Similarity | 0.5629 | NPC104011 |