Drug Information| Drug ID: | NPD8824 |
| Drug Name: | Favipiravir |
| Molecular Formula: | C5H4FN3O2 |
| Canonical SMILES: | Fc1cnc(c(n1)C(=O)N)O |
| Standard InCHI: | InChI=1S/C5H4FN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) |
| Standard InCHIKey: | ZCGNOVWYSGBHAU-UHFFFAOYSA-N |
| Max Developmental Stage: | Phase 3 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8824Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.75 | NPC317307 |
| Remote Similarity | 0.6885 | NPC180417 |
| Remote Similarity | 0.6593 | NPC144223 |
| Remote Similarity | 0.6288 | NPC240084 |
| Remote Similarity | 0.5856 | NPC100312 |
| Remote Similarity | 0.5856 | NPC204104 |
| Remote Similarity | 0.5804 | NPC270637 |
| Remote Similarity | 0.5778 | NPC63433 |
| Remote Similarity | 0.5674 | NPC109322 |
| Remote Similarity | 0.5634 | NPC180493 |