Drug Information| Drug ID: | NPD8812 |
| Drug Name: | Forigerimod Acetate |
| Molecular Formula: | C5H12NO5P.C2H4O2 |
| Canonical SMILES: | CC(=O)O.CN[C@H](C(=O)C)COP(=O)(O)O |
| Standard InCHI: | InChI=1S/C5H12NO5P.C2H4O2/c1-4(7)5(6-2)3-11-12(8,9)10;1-2(3)4/h5-6H,3H2,1-2H3,(H2,8,9,10);1H3,(H,3,4)/t5-;/m0./s1 |
| Standard InCHIKey: | RZLQANFWSBJHDK-JEDNCBNOSA-N |
| Max Developmental Stage: | Phase 3 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8812Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6964 | NPC286989 |
| Remote Similarity | 0.6364 | NPC198301 |
| Remote Similarity | 0.6271 | NPC315977 |
| Remote Similarity | 0.6102 | NPC93888 |
| Remote Similarity | 0.6102 | NPC270805 |
| Remote Similarity | 0.6 | NPC292422 |