Drug Information| Drug ID: | NPD8793 |
| Drug Name: | |
| Molecular Formula: | C5H11N2O2.ClH.Hg |
| Canonical SMILES: | [O-]C(=N)NCC(OC)[CH2].Cl.[198Hg+] |
| Standard InCHI: | InChI=1S/C5H11N2O2.ClH.Hg/c1-4(9-2)3-7-5(6)8;;/h4H,1,3H2,2H3,(H3,6,7,8);1H;/q;;+1/p-1/i;;1-4 |
| Standard InCHIKey: | BJFGVYCULWBXKF-WUYZZQIKSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD8793Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7