Drug Information| Drug ID: | NPD8619 |
| Drug Name: | Gamma Hydroxybutyric Acid |
| Molecular Formula: | C4H8O3 |
| Canonical SMILES: | OCCCC(=O)[O-] |
| Standard InCHI: | InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 |
| Standard InCHIKey: | SJZRECIVHVDYJC-UHFFFAOYSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; DrugBank |
Structural Similarity Between NPASS Natural Products and NPD8619Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Molecular Weight | 103.04 |
| ALogP | -1.6195 |
| MLogP | 1.57 |
| XLogP | -1.082 |
| HDA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| TPSA | 60.36 |
| RO5 Violation | 0 |