Drug Information| Drug ID: | NPD8613 |
| Drug Name: | Acetylglycinamide Chloral Hydrate |
| Molecular Formula: | C4H8N2O2.C2H3Cl3O2 |
| Canonical SMILES: | OC(C(Cl)(Cl)Cl)O.CC(=NCC(=N)O)O |
| Standard InCHI: | InChI=1S/C4H8N2O2.C2H3Cl3O2/c1-3(7)6-2-4(5)8;3-2(4,5)1(6)7/h2H2,1H3,(H2,5,8)(H,6,7);1,6-7H |
| Standard InCHIKey: | IYWCBBFJDGWEAZ-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8613Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7