Drug Information| Drug ID: | NPD8603 |
| Drug Name: | Potassium Sodium Tartrate |
| Molecular Formula: | C4H6O6.K.Na |
| Canonical SMILES: | O[C@H]([C@H](C(=O)[O-])O)C(=O)[O-].[Na+].[K+] |
| Standard InCHI: | InChI=1S/C4H6O6.K.Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
| Standard InCHIKey: | LJCNRYVRMXRIQR-OLXYHTOASA-L |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8603Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7