Drug Information| Drug ID:   | NPD8599 |
| Drug Name:   | Aluminium Acetotartrate |
| Molecular Formula:   | C4H6O6.C2H4O2.Al |
| Canonical SMILES:   | OC(C(C(=O)[O-])O)C(=O)[O-].[O-]C(=O)C.[Al+3] |
| Standard InCHI:   | "InChI=1S/C4H6O6.C2H4O2.Al/c5-1(3(7)8)2(6)4(9)10;1-2(3)4;/h1-2,5-6H,(H,7,8)(H,9,10);1H3,(H,3,4);/q;;+3/p-3" |
| Standard InCHIKey:   | KQVRYPWCDUCYPZ-UHFFFAOYSA-K |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8599Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9231 | NPC100749 |
| Remote Similarity | 0.625 | NPC326760 |
| Remote Similarity | 0.6 | NPC320218 |
| Remote Similarity | 0.6 | NPC317121 |
| Remote Similarity | 0.6 | NPC152099 |
| Remote Similarity | 0.5882 | NPC329534 |
| Remote Similarity | 0.5882 | NPC316493 |
| Remote Similarity | 0.5882 | NPC317436 |
| Remote Similarity | 0.5556 | NPC231722 |
| Remote Similarity | 0.5556 | NPC192400 |
| Remote Similarity | 0.5556 | NPC325303 |
| Remote Similarity | 0.5556 | NPC20286 |
| Remote Similarity | 0.5556 | NPC19045 |
| Remote Similarity | 0.5556 | NPC22339 |
| Remote Similarity | 0.55 | NPC185339 |
| Remote Similarity | 0.5385 | NPC68874 |
| Remote Similarity | 0.5385 | NPC327795 |
| Remote Similarity | 0.5333 | NPC165123 |
| Remote Similarity | 0.5263 | NPC318721 |
| Remote Similarity | 0.5263 | NPC322601 |
| Remote Similarity | 0.5263 | NPC328411 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 148 |
| ALogP   | -3.07 |
| MLogP   | 1.24 |
| XLogP   | -3.2 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 7 |
| TPSA   | 120.72 |
| RO5 Violation   | 0 |