Drug Information| Drug ID: | NPD8594 |
| Drug Name: | Succinic acid |
| Molecular Formula: | C4H6O4 |
| Canonical SMILES: | OC(=O)CCC(=O)O |
| Standard InCHI: | InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| Standard InCHIKey: | KDYFGRWQOYBRFD-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; DrugBank |
Structural Similarity Between NPASS Natural Products and NPD8594Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| TTD | DIB005716; DAP000545 |
| DrugBank | DB00139 |
| ChEMBL | CHEMBL576 |
| IUPHAR/BPS | |
| PharmaGKB | PA164747739 |
| KEGG Drug | |
| PubChem CID | 1110 |
| ChEBI | 15741 |
| CAS Number | 110-15-6 |
| Molecular Weight | 118.03 |
| ALogP | -0.41 |
| MLogP | 1.46 |
| XLogP | -0.71 |
| HDA | 4 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| TPSA | 74.6 |
| RO5 Violation | 0 |