Drug Information| Drug ID:   | NPD8591 |
| Drug Name:   | Lithium Succinate |
| Molecular Formula:   | C4H6O4.2Li |
| Canonical SMILES:   | [O-]C(=O)CCC(=O)[O-].[Li+].[Li+] |
| Standard InCHI:   | "InChI=1S/C4H6O4.2Li/c5-3(6)1-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;/q;2*+1/p-2" |
| Standard InCHIKey:   | WAHQBNXSPALNEA-UHFFFAOYSA-L |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8591Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC169697 |
| Remote Similarity | 0.5833 | NPC238637 |
| Remote Similarity | 0.5714 | NPC320914 |
| Remote Similarity | 0.5714 | NPC260610 |
| Remote Similarity | 0.5714 | NPC318872 |
| Remote Similarity | 0.5714 | NPC57349 |
| Remote Similarity | 0.5714 | NPC149193 |
| Remote Similarity | 0.5455 | NPC68874 |
| Remote Similarity | 0.5455 | NPC327795 |
| Remote Similarity | 0.5333 | NPC325257 |
| Remote Similarity | 0.5333 | NPC320703 |
| Remote Similarity | 0.5333 | NPC320982 |
| Remote Similarity | 0.5294 | NPC560137 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 116.01 |
| ALogP   | -1.7656 |
| MLogP   | 1.46 |
| XLogP   | -1.672 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 5 |
| TPSA   | 80.26 |
| RO5 Violation   | 0 |