Drug Information| Drug ID: | NPD8585 |
| Drug Name: | |
| Molecular Formula: | C4H6N4O12 |
| Canonical SMILES: | O=N(=O)OC(C(ON(=O)=O)CON(=O)=O)CON(=O)=O |
| Standard InCHI: | InChI=1S/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2 |
| Standard InCHIKey: | SNFOERUNNSHUGP-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD8585Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6429 | NPC85078 |
| Remote Similarity | 0.5882 | NPC301586 |
| Remote Similarity | 0.5882 | NPC33415 |
| Remote Similarity | 0.5758 | NPC190117 |
| Remote Similarity | 0.5625 | NPC84750 |