Drug Information| Drug ID: | NPD8576 |
| Drug Name: | Succinimide |
| Molecular Formula: | C4H5NO2 |
| Canonical SMILES: | OC1=NC(=O)CC1 |
| Standard InCHI: | InChI=1S/C4H5NO2/c6-3-1-2-4(7)5-3/h1-2H2,(H,5,6,7) |
| Standard InCHIKey: | KZNICNPSHKQLFF-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8576Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC33721 |
| Intermediate Similarity | 0.8 | NPC21142 |
| Intermediate Similarity | 0.7368 | NPC145895 |
| Remote Similarity | 0.66 | NPC29950 |
| Remote Similarity | 0.66 | NPC19576 |
| Remote Similarity | 0.6486 | NPC290188 |
| Remote Similarity | 0.6078 | NPC327239 |
| Remote Similarity | 0.5962 | NPC471131 |
| Remote Similarity | 0.5833 | NPC43264 |
| Remote Similarity | 0.5789 | NPC292299 |
| Remote Similarity | 0.5789 | NPC34838 |
| Remote Similarity | 0.569 | NPC263207 |