Drug Information| Drug ID: | NPD8570 |
| Drug Name: | Flucytosine |
| Molecular Formula: | C4H4FN3O |
| Canonical SMILES: | Oc1ncc(c(=N)[nH]1)F |
| Standard InCHI: | InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
| Standard InCHIKey: | XRECTZIEBJDKEO-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8570Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8571 | NPC212436 |
| Remote Similarity | 0.6364 | NPC230087 |
| Remote Similarity | 0.5606 | NPC326909 |
| Molecular Weight | 129.03 |
| ALogP | -0.7383 |
| MLogP | 1.35 |
| XLogP | 0.279 |
| HDA | 4 |
| HBD | 3 |
| Rotatable Bonds | 2 |
| TPSA | 68.47 |
| RO5 Violation | 0 |