Drug Information| Drug ID: | NPD8555 |
| Drug Name: | Metformin |
| Molecular Formula: | C4H11N5 |
| Canonical SMILES: | CN(C(=N)NC(=N)N)C |
| Standard InCHI: | InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
| Standard InCHIKey: | XZWYZXLIPXDOLR-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD8555Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| TTD | DAP000205; DIB014097 |
| DrugBank | DB00331 |
| ChEMBL | CHEMBL1431 |
| IUPHAR/BPS | 4779 |
| PharmaGKB | PA450395 |
| KEGG Drug | D04966 |
| PubChem CID | 4091 |
| ChEBI | 6801 |
| CAS Number | 657-24-9 |
| Molecular Weight | 129.10 |
| ALogP | -0.2231 |
| MLogP | 1.35 |
| XLogP | 0.558 |
| HDA | 5 |
| HBD | 4 |
| Rotatable Bonds | 6 |
| TPSA | 88.99 |
| RO5 Violation | 0 |