Drug Information| Drug ID:   | NPD835 |
| Drug Name:   | Secobarbital |
| Molecular Formula:   | C12H18N2O3 |
| Canonical SMILES:   | CCCC(C1(CC=C)C(=NC(=O)N=C1O)O)C |
| Standard InCHI:   | "InChI=1S/C12H18N2O3/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)" |
| Standard InCHIKey:   | KQPKPCNLIDLUMF-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD835Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 238.13 |
| ALogP   | -0.2495 |
| MLogP   | 2.23 |
| XLogP   | 3.272 |
| HDA   | 5 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 82.25 |
| RO5 Violation   | 0 |