Drug Information| Drug ID:   | NPD8207 |
| Drug Name:   | Dihydroxyacetone |
| Molecular Formula:   | C3H6O3 |
| Canonical SMILES:   | OCC(=O)CO |
| Standard InCHI:   | "InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2" |
| Standard InCHIKey:   | RXKJFZQQPQGTFL-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8207Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC82694 |
| Intermediate Similarity | 0.8 | NPC11813 |
| Intermediate Similarity | 0.8 | NPC321033 |
| Remote Similarity | 0.6154 | NPC39740 |
| Remote Similarity | 0.5714 | NPC163148 |
| Remote Similarity | 0.5714 | NPC515233 |
| Remote Similarity | 0.5455 | NPC192668 |
| Remote Similarity | 0.5333 | NPC246123 |
| TTD   | DIB010016 |
| DrugBank   | DB01775 |
| ChEMBL   | CHEMBL1229937 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 16016 |
| CAS Number   | 96-26-4 |
| Molecular Weight   | 90.03 |
| ALogP   | -1.588 |
| MLogP   | 1.46 |
| XLogP   | -1.889 |
| HDA   | 3 |
| HBD   | 2 |
| Rotatable Bonds   | 4 |
| TPSA   | 57.53 |
| RO5 Violation   | 0 |