Drug Information| Drug ID:   | NPD8200 |
| Drug Name:   | Sodium Propionate |
| Molecular Formula:   | C3H6O2.Na |
| Canonical SMILES:   | [O-]C(=O)CC.[Na+] |
| Standard InCHI:   | "InChI=1S/C3H6O2.Na/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1" |
| Standard InCHIKey:   | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8200Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC238637 |
| Remote Similarity | 0.6364 | NPC284970 |
| Remote Similarity | 0.6154 | NPC320914 |
| Remote Similarity | 0.6154 | NPC260610 |
| Remote Similarity | 0.6154 | NPC149193 |
| Remote Similarity | 0.6 | NPC68874 |
| Remote Similarity | 0.6 | NPC327795 |
| Remote Similarity | 0.5833 | NPC169697 |
| Remote Similarity | 0.5833 | NPC89025 |
| Remote Similarity | 0.5833 | NPC213481 |
| Remote Similarity | 0.5833 | NPC313620 |
| Remote Similarity | 0.5714 | NPC320982 |
| Remote Similarity | 0.5385 | NPC320218 |
| Remote Similarity | 0.5385 | NPC317121 |
| Remote Similarity | 0.5385 | NPC152099 |
| Remote Similarity | 0.5333 | NPC319195 |
| Remote Similarity | 0.5333 | NPC327658 |
| Remote Similarity | 0.5333 | NPC318915 |
| Remote Similarity | 0.5333 | NPC281669 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 73.03 |
| ALogP   | -0.8315 |
| MLogP   | 1.57 |
| XLogP   | -0.308 |
| HDA   | 2 |
| HBD   | 0 |
| Rotatable Bonds   | 3 |
| TPSA   | 40.13 |
| RO5 Violation   | 0 |