Drug Information| Drug ID:   | NPD8160 |
| Drug Name:   | "HPPH photodynamic therapy (cancer), Roswell Park" |
| Molecular Formula:   | C39H48N4O4 |
| Canonical SMILES:   | CCCCCCOC(c1c2=CC3=NC(=Cc4[nH]c5C(=C6N=C(C=c(c1C)[nH]2)[C@@H](C)[C@@H]6CCC(=O)O)CC(=O)c5c4C)C(=C3C)CC)C |
| Standard InCHI:   | "InChI=1S/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,41,43H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17?,31-18-,32-18?,33-19?,38-27?/t21-,24?,26-/m0/s1" |
| Standard InCHIKey:   | PVXGCBZIVFCMJK-UOFJUDOESA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8160Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7283 | NPC195457 |
| Intermediate Similarity | 0.7283 | NPC560165 |
| Intermediate Similarity | 0.7283 | NPC602089 |
| Remote Similarity | 0.6842 | NPC547227 |
| Remote Similarity | 0.6531 | NPC509452 |
| Remote Similarity | 0.6465 | NPC572209 |
| Remote Similarity | 0.581 | NPC542925 |
| Remote Similarity | 0.566 | NPC268676 |
| Remote Similarity | 0.566 | NPC574307 |
| Remote Similarity | 0.5566 | NPC187255 |
| Remote Similarity | 0.5566 | NPC587357 |
| Remote Similarity | 0.5321 | NPC85702 |
| Remote Similarity | 0.5321 | NPC597178 |
| Molecular Weight   | 636.37 |
| ALogP   | -0.1247 |
| MLogP   | 4.87 |
| XLogP   | 6.635 |
| HDA   | 8 |
| HBD   | 3 |
| Rotatable Bonds   | 19 |
| TPSA   | 120.96 |
| RO5 Violation   | 2 |