Drug Information| Drug ID:   | NPD8144 |
| Drug Name:   | Decamethoxine |
| Molecular Formula:   | C38H74N2O4 |
| Canonical SMILES:   | CC1CCC(C(C1)OC(=O)C[N+](CCCCCCCCCC[N+](CC(=O)OC1CC(C)CCC1C(C)C)(C)C)(C)C)C(C)C |
| Standard InCHI:   | "InChI=1S/C38H74N2O4/c1-29(2)33-21-19-31(5)25-35(33)43-37(41)27-39(7,8)23-17-15-13-11-12-14-16-18-24-40(9,10)28-38(42)44-36-26-32(6)20-22-34(36)30(3)4/h29-36H,11-28H2,1-10H3/q+2" |
| Standard InCHIKey:   | ZADGGFKUEYIBJC-UHFFFAOYSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8144Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5366 | NPC291724 |
| Remote Similarity | 0.5366 | NPC145216 |
| Remote Similarity | 0.5366 | NPC274261 |
| Remote Similarity | 0.5366 | NPC128550 |
| Remote Similarity | 0.5366 | NPC189318 |
| Remote Similarity | 0.5366 | NPC145157 |
| Remote Similarity | 0.5366 | NPC70850 |
| Remote Similarity | 0.5366 | NPC309472 |
| Remote Similarity | 0.5366 | NPC511480 |
| Remote Similarity | 0.5116 | NPC187061 |
| Remote Similarity | 0.5106 | NPC328814 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 622.56 |
| ALogP   | -3.112 |
| MLogP   | 4.98 |
| XLogP   | 10.068 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 31 |
| TPSA   | 52.6 |
| RO5 Violation   | 2 |