Drug Information| Drug ID:   | NPD808 |
| Drug Name:   | Thiamine |
| Molecular Formula:   | C12H17N4OS |
| Canonical SMILES:   | OCCc1sc[n+](c1C)Cc1cnc([nH]c1=N)C |
| Standard InCHI:   | "InChI=1S/C12H17N4OS/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15)/q+1" |
| Standard InCHIKey:   | JZRWCGZRTZMZEH-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD808Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC150950 |
| High Similarity | 0.9796 | NPC189436 |
| High Similarity | 0.9796 | NPC125076 |
| Remote Similarity | 0.6176 | NPC320833 |
| Remote Similarity | 0.5645 | NPC242203 |
| Remote Similarity | 0.5161 | NPC611796 |
| Molecular Weight   | 265.11 |
| ALogP   | -2.3748 |
| MLogP   | 2.12 |
| XLogP   | 0.641 |
| HDA   | 4 |
| HBD   | 3 |
| Rotatable Bonds   | 7 |
| TPSA   | 100.59 |
| RO5 Violation   | 0 |