Drug Information| Drug ID:   | NPD8076 |
| Drug Name:   | ZD-7349 |
| Molecular Formula:   | C37H60N12O8 |
| Canonical SMILES:   | NC(=N)NCCC[C@H]1N=C(O)[C@@H](N=C(O)[C@H](CC(=O)O)N=C(O)[C@@H](N=C([C@@H](N(C(=O)[C@H](N=C1O)CCCNC(=N)N)C)Cc1ccccc1)O)CC(C)C)C(C)C |
| Standard InCHI:   | "InChI=1S/C37H60N12O8/c1-20(2)17-25-31(53)46-26(19-28(50)51)32(54)48-29(21(3)4)34(56)44-23(13-9-15-42-36(38)39)30(52)45-24(14-10-16-43-37(40)41)35(57)49(5)27(33(55)47-25)18-22-11-7-6-8-12-22/h6-8,11-12,20-21,23-27,29H,9-10,13-19H2,1-5H3,(H,44,56)(H,45,52)(H,46,53)(H,47,55)(H,48,54)(H,50,51)(H4,38,39,42)(H4,40,41,43)/t23-,24-,25+,26+,27+,29+/m1/s1" |
| Standard InCHIKey:   | ITSLWDIDZVSBNW-BISUKRMJSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8076Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5556 | NPC61332 |
| Remote Similarity | 0.5372 | NPC240130 |
| Remote Similarity | 0.5248 | NPC244219 |
| Remote Similarity | 0.5167 | NPC489549 |
| Molecular Weight   | 800.47 |
| ALogP   | -2.6921 |
| MLogP   | 3.33 |
| XLogP   | 3.502 |
| HDA   | 20 |
| HBD   | 12 |
| Rotatable Bonds   | 30 |
| TPSA   | 344.36 |
| RO5 Violation   | 3 |