Drug Information| Drug ID:   | NPD8038 |
| Drug Name:   | "Davunetide (Intranasal Spray), Allon; Davunetide" |
| Molecular Formula:   | C36H60N10O12 |
| Canonical SMILES:   | OC[C@@H](C(=N[C@H](C(=O)N1CCC[C@H]1C(=N[C@H](C(=O)O)CCC(=N)O)O)[C@H](CC)C)O)N=C([C@H](C(C)C)N=C([C@@H]1CCCN1C(=O)[C@@H](N=C([C@H](CC(=N)O)N)O)C)O)O |
| Standard InCHI:   | "InChI=1S/C36H60N10O12/c1-6-18(4)28(35(56)46-14-8-9-23(46)31(52)41-21(36(57)58)11-12-25(38)48)44-30(51)22(16-47)42-33(54)27(17(2)3)43-32(53)24-10-7-13-45(24)34(55)19(5)40-29(50)20(37)15-26(39)49/h17-24,27-28,47H,6-16,37H2,1-5H3,(H2,38,48)(H2,39,49)(H,40,50)(H,41,52)(H,42,54)(H,43,53)(H,44,51)(H,57,58)/t18-,19-,20-,21-,22-,23-,24-,27-,28-/m0/s1" |
| Standard InCHIKey:   | DWLTUUXCVGVRAV-XWRHUKJGSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD8038Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 824.44 |
| ALogP   | -5.3623 |
| MLogP   | 3 |
| XLogP   | -3.437 |
| HDA   | 22 |
| HBD   | 12 |
| Rotatable Bonds   | 39 |
| TPSA   | 375.28 |
| RO5 Violation   | 3 |