Drug Information| Drug ID:   | NPD8026 |
| Drug Name:   | CR-665 |
| Molecular Formula:   | C36H49N9O4 |
| Canonical SMILES:   | CCCC[C@H](C(=N[C@@H](C(=NCc1ccncc1)O)CCCNC(=N)N)O)N=C([C@H](N=C([C@@H](Cc1ccccc1)N)O)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C36H49N9O4/c1-2-3-15-30(34(48)43-29(16-10-19-41-36(38)39)33(47)42-24-27-17-20-40-21-18-27)44-35(49)31(23-26-13-8-5-9-14-26)45-32(46)28(37)22-25-11-6-4-7-12-25/h4-9,11-14,17-18,20-21,28-31H,2-3,10,15-16,19,22-24,37H2,1H3,(H,42,47)(H,43,48)(H,44,49)(H,45,46)(H4,38,39,41)/t28-,29-,30-,31-/m1/s1" |
| Standard InCHIKey:   | DBOGGOVKHSCMNB-OMRVPHBLSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD8026Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5789 | NPC267237 |
| Molecular Weight   | 671.39 |
| ALogP   | -3.6391 |
| MLogP   | 3.99 |
| XLogP   | 7.989 |
| HDA   | 13 |
| HBD   | 8 |
| Rotatable Bonds   | 28 |
| TPSA   | 231.17 |
| RO5 Violation   | 4 |