NPASS drugs

Drug Information

Drug ID:	NPD7956
Drug Name:	Rescinnamine
Molecular Formula:	C35H42N2O9
Canonical SMILES:	COc1ccc2c(c1)[nH]c1c2CCN2[C@@H]1C[C@H]1[C@@H](C2)C[C@H]([C@@H]([C@H]1C(=O)OC)OC)OC(=O)C=Cc1cc(OC)c(c(c1)OC)OC
Standard InCHI:	"InChI=1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/t20-,24+,26-,29-,31+,34+/m1/s1"
Standard InCHIKey:	SZLZWPPUNLXJEA-LAFLMMDJSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD7956

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	110707
0.1-0.2	98696
0.2-0.3	2058
0.3-0.4	178
0.4-0.5	72
0.5-0.6	13
0.6-0.7	5
0.7-0.8	7
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC284685
High Similarity	1.0	NPC66363
High Similarity	1.0	NPC611590
Intermediate Similarity	0.7835	NPC173634
Intermediate Similarity	0.7835	NPC521451
Intermediate Similarity	0.7708	NPC100734
Intermediate Similarity	0.7708	NPC88923
Intermediate Similarity	0.7708	NPC315634
Intermediate Similarity	0.7708	NPC603759
Intermediate Similarity	0.7708	NPC612008
Remote Similarity	0.6505	NPC63310
Remote Similarity	0.6505	NPC191489
Remote Similarity	0.6505	NPC611619
Remote Similarity	0.6495	NPC505862
Remote Similarity	0.6392	NPC515564
Remote Similarity	0.5859	NPC511098
Remote Similarity	0.5859	NPC519056
Remote Similarity	0.5859	NPC529689
Remote Similarity	0.5859	NPC596131
Remote Similarity	0.5522	NPC60946
Remote Similarity	0.5495	NPC19445
Remote Similarity	0.5357	NPC321871
Remote Similarity	0.5357	NPC303096
Remote Similarity	0.5315	NPC579238
Remote Similarity	0.5288	NPC21638
Remote Similarity	0.5288	NPC241812
Remote Similarity	0.5146	NPC514799
Remote Similarity	0.5146	NPC578730

Drug Structure

NPD7956 OpenBabel08211712032D 47 52 0 0 1 0 0 0 0 0999 V2000 3.9841 0.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0491 3.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5518 3.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6760 3.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4650 -4.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1214 -2.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8015 -0.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5047 1.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6701 1.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9259 -1.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6699 1.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5046 1.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9254 0.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6768 0.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1746 -1.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6698 -0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6705 -0.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3396 0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8012 0.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3398 -0.9630 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5045 0.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8349 1.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8348 1.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5053 -1.4451 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8347 0.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6703 0.0003 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9251 1.6366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6765 1.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1748 -2.4085 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9262 -2.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5055 -2.4089 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8350 0.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8007 2.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3403 -2.8906 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6300 -2.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5048 0.4824 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 -6.8020 -2.9133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6302 -3.9258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3390 -0.0006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0493 2.1419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5520 2.1428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8004 3.1535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3406 -3.9017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7542 -2.4093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0507 -2.9138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0002 -1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 40 1 0 0 0 0 2 41 1 0 0 0 0 3 42 1 0 0 0 0 4 43 1 0 0 0 0 5 44 1 0 0 0 0 6 45 1 0 0 0 0 7 10 2 3 0 0 0 7 19 1 0 0 0 0 8 9 2 0 0 0 0 8 21 1 0 0 0 0 9 22 1 0 0 0 0 10 30 1 0 0 0 0 11 12 1 0 0 0 0 11 23 1 0 0 0 0 12 37 1 0 0 0 0 13 19 2 0 0 0 0 13 27 1 0 0 0 0 14 19 1 0 0 0 0 14 28 2 0 0 0 0 15 29 1 0 0 0 0 16 21 2 0 0 0 0 16 25 1 0 0 0 0 17 26 1 0 0 0 0 18 20 1 0 0 0 0 18 37 1 0 0 0 0 20 15 1 6 0 0 0 20 24 1 0 0 0 0 21 40 1 0 0 0 0 22 23 1 0 0 0 0 22 25 2 0 0 0 0 23 32 2 0 0 0 0 24 17 1 6 0 0 0 24 31 1 0 0 0 0 25 36 1 0 0 0 0 26 32 1 0 0 0 0 26 37 1 1 0 0 0 27 33 2 0 0 0 0 27 41 1 0 0 0 0 28 33 1 0 0 0 0 28 42 1 0 0 0 0 29 34 1 0 0 0 0 29 46 1 6 0 0 0 30 38 2 0 0 0 0 30 46 1 0 0 0 0 31 34 1 0 0 0 0 31 35 1 6 0 0 0 32 36 1 0 0 0 0 33 43 1 0 0 0 0 34 44 1 1 0 0 0 35 39 2 0 0 0 0 35 45 1 0 0 0 0 36 47 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000910
DrugBank	DB01180
ChEMBL	CHEMBL1668
IUPHAR/BPS
PharmaGKB	PA164768818
KEGG Drug	D00198
PubChem CID	0
ChEBI	28572
CAS Number	24815-24-5

Drug Properties

Molecular Weight	634.29
ALogP	-0.5031
MLogP	4.1
XLogP	3.388
HDA	7
HBD	1
Rotatable Bonds	17
TPSA	117.78
RO5 Violation	1