Drug Information| Drug ID:   | NPD7910 |
| Drug Name:   | |
| Molecular Formula:   | C34H55NO3 |
| Canonical SMILES:   | CCCCN(C(=O)CCCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O)C |
| Standard InCHI:   | "InChI=1S/C34H55NO3/c1-4-5-22-35(3)32(38)15-13-11-9-7-6-8-10-12-14-25-23-26-24-27(36)16-17-28(26)29-20-21-34(2)30(33(25)29)18-19-31(34)37/h16-17,24-25,29-31,33,36-37H,4-15,18-23H2,1-3H3/t25-,29-,30+,31+,33-,34+/m1/s1" |
| Standard InCHIKey:   | BVVFOLSZMQVDKV-KXQIQQEYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7910Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7436 | NPC485859 |
| Remote Similarity | 0.6506 | NPC611420 |
| Remote Similarity | 0.5833 | NPC48342 |
| Remote Similarity | 0.5833 | NPC294638 |
| Remote Similarity | 0.5833 | NPC328831 |
| Remote Similarity | 0.5833 | NPC164649 |
| Remote Similarity | 0.5833 | NPC290287 |
| Remote Similarity | 0.5833 | NPC601860 |
| Remote Similarity | 0.5833 | NPC609599 |
| Remote Similarity | 0.5479 | NPC328504 |
| Molecular Weight   | 525.42 |
| ALogP   | -3.5602 |
| MLogP   | 4.76 |
| XLogP   | 10.252 |
| HDA   | 3 |
| HBD   | 2 |
| Rotatable Bonds   | 20 |
| TPSA   | 60.77 |
| RO5 Violation   | 2 |