Drug Information| Drug ID:   | NPD7866 |
| Drug Name:   | |
| Molecular Formula:   | C34H34N4O4 |
| Canonical SMILES:   | C=Cc1c2/C=C/3N=C(C(=C3C)CCC(=O)O)/C=C/3N=C(C=c4[n-]/c(=Cc(c1C)[nH]2)/c(C=C)c4C)C(=C3CCC(=O)[O-])C |
| Standard InCHI:   | "InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42)/p-2/b25-13?,26-13-,27-14?,28-15-,29-14-,30-15?,31-16-,32-16?" |
| Standard InCHIKey:   | PRFMATRBBQRQBM-ZUXVXFAZSA-L |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7866Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC190132 |
| High Similarity | 0.8904 | NPC76529 |
| Remote Similarity | 0.6628 | NPC150540 |
| Remote Similarity | 0.6494 | NPC494670 |
| Remote Similarity | 0.6486 | NPC311984 |
| Remote Similarity | 0.5647 | NPC32308 |
| Remote Similarity | 0.5647 | NPC549138 |
| Remote Similarity | 0.5647 | NPC603585 |
| Remote Similarity | 0.5529 | NPC489879 |
| Remote Similarity | 0.5176 | NPC537463 |
| Remote Similarity | 0.5176 | NPC578791 |
| Remote Similarity | 0.5161 | NPC563651 |
| Remote Similarity | 0.5116 | NPC500039 |
| Remote Similarity | 0.5116 | NPC560507 |
| Remote Similarity | 0.5102 | NPC548201 |
| Remote Similarity | 0.5062 | NPC291617 |
| Remote Similarity | 0.5062 | NPC41173 |
| Remote Similarity | 0.5062 | NPC568425 |
| Remote Similarity | 0.5062 | NPC575957 |
| Remote Similarity | 0.5054 | NPC498022 |
| Molecular Weight   | 560.24 |
| ALogP   | 2.1396 |
| MLogP   | 4.32 |
| XLogP   | 2.124 |
| HDA   | 8 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 114.18 |
| RO5 Violation   | 0 |