Drug Information| Drug ID:   | NPD7865 |
| Drug Name:   | |
| Molecular Formula:   | C34H34N4O4 |
| Canonical SMILES:   | C=Cc1c2C=C3N=C(C(=C3C)CCC(=O)O)C=C3N=C(C=c4[nH]c(=Cc(c1C)[nH]2)c(C=C)c4C)C(=C3CCC(=O)O)C |
| Standard InCHI:   | "InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,35-36H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42)/b25-13?,26-13-,27-14-,28-15?,29-14?,30-15-,31-16?,32-16-" |
| Standard InCHIKey:   | ZCFFYALKHPIRKJ-MQQVFJQGSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7865Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC494670 |
| Intermediate Similarity | 0.7121 | NPC500039 |
| Intermediate Similarity | 0.7121 | NPC560507 |
| Intermediate Similarity | 0.7059 | NPC32308 |
| Intermediate Similarity | 0.7059 | NPC549138 |
| Intermediate Similarity | 0.7059 | NPC603585 |
| Intermediate Similarity | 0.7013 | NPC548201 |
| Remote Similarity | 0.697 | NPC537463 |
| Remote Similarity | 0.697 | NPC578791 |
| Remote Similarity | 0.6667 | NPC549363 |
| Remote Similarity | 0.6494 | NPC190132 |
| Remote Similarity | 0.6406 | NPC291617 |
| Remote Similarity | 0.6406 | NPC41173 |
| Remote Similarity | 0.6406 | NPC568425 |
| Remote Similarity | 0.6406 | NPC575957 |
| Remote Similarity | 0.64 | NPC498022 |
| Remote Similarity | 0.6316 | NPC563651 |
| Remote Similarity | 0.6154 | NPC558388 |
| Remote Similarity | 0.5732 | NPC582400 |
| Remote Similarity | 0.5595 | NPC518670 |
| Remote Similarity | 0.5571 | NPC494037 |
| Remote Similarity | 0.5513 | NPC76529 |
| Remote Similarity | 0.5301 | NPC516208 |
| Remote Similarity | 0.5176 | NPC219905 |
| Remote Similarity | 0.5176 | NPC195457 |
| Remote Similarity | 0.5176 | NPC560165 |
| Remote Similarity | 0.5176 | NPC566002 |
| Remote Similarity | 0.5176 | NPC602089 |
| Remote Similarity | 0.5116 | NPC547227 |
| Remote Similarity | 0.5057 | NPC507246 |
| TTD   | DNAP001543 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 3086464 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 562.26 |
| ALogP   | 3.0102 |
| MLogP   | 4.32 |
| XLogP   | 4.87 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 14 |
| TPSA   | 131.96 |
| RO5 Violation   | 0 |