NPASS drugs

Drug Information

Drug ID:	NPD7803
Drug Name:	Reserpine
Molecular Formula:	C33H40N2O9
Canonical SMILES:	COc1ccc2c(c1)[nH]c1c2CCN2[C@@H]1C[C@H]1[C@@H](C2)C[C@H]([C@@H]([C@H]1C(=O)OC)OC)OC(=O)c1cc(OC)c(c(c1)OC)OC
Standard InCHI:	"InChI=1S/C33H40N2O9/c1-38-19-7-8-20-21-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)22(18)15-24(35)29(21)34-23(20)14-19/h7-8,11-12,14,18,22,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,22+,24-,27-,28+,31+/m1/s1"
Standard InCHIKey:	QEVHRUUCFGRFIF-MDEJGZGSSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD7803

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	123744
0.1-0.2	86356
0.2-0.3	1358
0.3-0.4	165
0.4-0.5	88
0.5-0.6	6
0.6-0.7	10
0.7-0.8	5
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	5

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC100734
High Similarity	1.0	NPC88923
High Similarity	1.0	NPC315634
High Similarity	1.0	NPC603759
High Similarity	1.0	NPC612008
Intermediate Similarity	0.8444	NPC63310
Intermediate Similarity	0.8444	NPC191489
Intermediate Similarity	0.8444	NPC611619
Intermediate Similarity	0.7789	NPC173634
Intermediate Similarity	0.7789	NPC521451
Intermediate Similarity	0.7708	NPC284685
Intermediate Similarity	0.7708	NPC66363
Intermediate Similarity	0.7708	NPC611590
Remote Similarity	0.686	NPC60946
Remote Similarity	0.6634	NPC19445
Remote Similarity	0.6596	NPC505862
Remote Similarity	0.6489	NPC515564
Remote Similarity	0.6471	NPC321871
Remote Similarity	0.6471	NPC303096
Remote Similarity	0.6105	NPC511098
Remote Similarity	0.6105	NPC519056
Remote Similarity	0.6105	NPC529689
Remote Similarity	0.6105	NPC596131
Remote Similarity	0.5514	NPC579238
Remote Similarity	0.55	NPC21638
Remote Similarity	0.55	NPC241812
Remote Similarity	0.52	NPC506842
Remote Similarity	0.52	NPC514799
Remote Similarity	0.52	NPC578730

Drug Structure

NPD7803 OpenBabel08211712032D 45 50 0 0 1 0 0 0 0 0999 V2000 -3.9859 -0.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1757 -1.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6800 -1.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8038 -2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4661 4.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1214 2.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5058 -1.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6709 -1.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6706 -1.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5057 -1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0524 0.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8046 0.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1765 1.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6705 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6713 0.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3411 -0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9286 1.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3413 0.9634 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5056 -0.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8353 -1.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8352 -1.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5064 1.4458 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8351 -0.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6710 -0.0003 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0522 -0.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8043 -0.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1767 2.4096 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5067 2.4100 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8354 -0.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9281 -0.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3418 2.8919 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9289 2.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6307 2.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5059 -0.4827 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 6.8051 2.9147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6310 3.9276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3406 0.0006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1760 -0.6253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6803 -0.6262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9278 -1.6373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3421 3.9035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7545 2.4104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0529 2.9151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0002 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 38 1 0 0 0 0 2 39 1 0 0 0 0 3 40 1 0 0 0 0 4 41 1 0 0 0 0 5 42 1 0 0 0 0 6 43 1 0 0 0 0 7 8 2 0 0 0 0 7 19 1 0 0 0 0 8 20 1 0 0 0 0 9 10 1 0 0 0 0 9 21 1 0 0 0 0 10 35 1 0 0 0 0 11 17 2 0 0 0 0 11 25 1 0 0 0 0 12 17 1 0 0 0 0 12 26 2 0 0 0 0 13 27 1 0 0 0 0 14 19 2 0 0 0 0 14 23 1 0 0 0 0 15 24 1 0 0 0 0 16 18 1 0 0 0 0 16 35 1 0 0 0 0 17 32 1 0 0 0 0 18 13 1 6 0 0 0 18 22 1 0 0 0 0 19 38 1 0 0 0 0 20 21 1 0 0 0 0 20 23 2 0 0 0 0 21 29 2 0 0 0 0 22 15 1 6 0 0 0 22 28 1 0 0 0 0 23 34 1 0 0 0 0 24 29 1 0 0 0 0 24 35 1 1 0 0 0 25 30 2 0 0 0 0 25 39 1 0 0 0 0 26 30 1 0 0 0 0 26 40 1 0 0 0 0 27 31 1 0 0 0 0 27 44 1 6 0 0 0 28 31 1 0 0 0 0 28 33 1 6 0 0 0 29 34 1 0 0 0 0 30 41 1 0 0 0 0 31 42 1 1 0 0 0 32 36 2 0 0 0 0 32 44 1 0 0 0 0 33 37 2 0 0 0 0 33 43 1 0 0 0 0 34 45 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000755
DrugBank	DB00206
ChEMBL	CHEMBL772
IUPHAR/BPS	4823
PharmaGKB	PA451236
KEGG Drug	D00197
PubChem CID	5770
ChEBI	28487
CAS Number	50-55-5

Drug Properties

Molecular Weight	608.27
ALogP	-0.8642
MLogP	3.88
XLogP	2.783
HDA	7
HBD	1
Rotatable Bonds	16
TPSA	117.78
RO5 Violation	0