Drug Information| Drug ID:   | NPD7797 |
| Drug Name:   | Irinotecan |
| Molecular Formula:   | C33H38N4O6 |
| Canonical SMILES:   | CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccc(cc4c(c3Cn1c2=O)CC)OC(=O)N1CCC(CC1)N1CCCCC1 |
| Standard InCHI:   | "InChI=1S/C33H38N4O6/c1-3-22-23-16-21(43-32(40)36-14-10-20(11-15-36)35-12-6-5-7-13-35)8-9-27(23)34-29-24(22)18-37-28(29)17-26-25(30(37)38)19-42-31(39)33(26,41)4-2/h8-9,16-17,20,41H,3-7,10-15,18-19H2,1-2H3/t33-/m0/s1" |
| Standard InCHIKey:   | UWKQSNNFCGGAFS-XIFFEERXSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD7797Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC197381 |
| Remote Similarity | 0.596 | NPC276661 |
| Remote Similarity | 0.596 | NPC599818 |
| Remote Similarity | 0.54 | NPC106338 |
| Remote Similarity | 0.54 | NPC303320 |
| Remote Similarity | 0.54 | NPC541875 |
| Remote Similarity | 0.54 | NPC608071 |
| Molecular Weight   | 586.28 |
| ALogP   | -2.7949 |
| MLogP   | 3.99 |
| XLogP   | 3.633 |
| HDA   | 9 |
| HBD   | 1 |
| Rotatable Bonds   | 9 |
| TPSA   | 112.51 |
| RO5 Violation   | 0 |