Drug Information| Drug ID:   | NPD7743 |
| Drug Name:   | Fulvestrant |
| Molecular Formula:   | C32H47F5O3S |
| Canonical SMILES:   | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2C1[C@@H]1CC[C@@H]([C@]1(CC2)C)O |
| Standard InCHI:   | "InChI=1S/C32H47F5O3S/c1-30-17-15-26-25-12-11-24(38)21-23(25)20-22(29(26)27(30)13-14-28(30)39)10-7-5-3-2-4-6-8-18-41(40)19-9-16-31(33,34)32(35,36)37/h11-12,21-22,26-29,38-39H,2-10,13-20H2,1H3/t22-,26-,27+,28+,29?,30+,41?/m1/s1" |
| Standard InCHIKey:   | VWUXBMIQPBEWFH-LQKBAPIOSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD7743Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC485859 |
| Intermediate Similarity | 0.8077 | NPC611420 |
| Remote Similarity | 0.5325 | NPC48342 |
| Remote Similarity | 0.5325 | NPC294638 |
| Remote Similarity | 0.5325 | NPC328831 |
| Remote Similarity | 0.5325 | NPC164649 |
| Remote Similarity | 0.5325 | NPC290287 |
| Remote Similarity | 0.5325 | NPC601860 |
| Remote Similarity | 0.5325 | NPC609599 |
| Remote Similarity | 0.5195 | NPC328504 |
| TTD   | DAP000319 |
| DrugBank   | DB00947 |
| ChEMBL   | CHEMBL1712246 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164747170 |
| KEGG Drug   | D01161 |
| PubChem CID   | 0 |
| ChEBI   | 31638 |
| CAS Number   | 129453-61-8 |
| Molecular Weight   | 606.32 |
| ALogP   | -1.7457 |
| MLogP   | 3.99 |
| XLogP   | 10.614 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 23 |
| TPSA   | 76.74 |
| RO5 Violation   | 2 |