Drug Information| Drug ID:   | NPD7619 |
| Drug Name:   | Anamorelin |
| Molecular Formula:   | C31H42N6O3 |
| Canonical SMILES:   | O=C(N1CCC[C@](C1)(Cc1ccccc1)C(=O)N(N(C)C)C)[C@H](N=C(C(N)(C)C)O)Cc1c[nH]c2c1cccc2 |
| Standard InCHI:   | "InChI=1S/C31H42N6O3/c1-30(2,32)28(39)34-26(18-23-20-33-25-15-10-9-14-24(23)25)27(38)37-17-11-16-31(21-37,29(40)36(5)35(3)4)19-22-12-7-6-8-13-22/h6-10,12-15,20,26,33H,11,16-19,21,32H2,1-5H3,(H,34,39)/t26-,31-/m1/s1" |
| Standard InCHIKey:   | VQPFSIRUEPQQPP-MXBOTTGLSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7619Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5333 | NPC54657 |
| Remote Similarity | 0.5287 | NPC228835 |
| Remote Similarity | 0.5059 | NPC11126 |
| Remote Similarity | 0.5056 | NPC17059 |
| Remote Similarity | 0.5049 | NPC195941 |
| Remote Similarity | 0.5044 | NPC148787 |
| Molecular Weight   | 546.33 |
| ALogP   | -1.818 |
| MLogP   | 3.88 |
| XLogP   | 4.184 |
| HDA   | 9 |
| HBD   | 3 |
| Rotatable Bonds   | 18 |
| TPSA   | 118.26 |
| RO5 Violation   | 1 |