Drug Information| Drug ID:   | NPD7618 |
| Drug Name:   | Anamorelin Hydrochloride |
| Molecular Formula:   | C31H42N6O3.ClH |
| Canonical SMILES:   | O=C(N1CCC[C@](C1)(Cc1ccccc1)C(=O)N(N(C)C)C)[C@H](N=C(C(N)(C)C)O)Cc1c[nH]c2c1cccc2.Cl |
| Standard InCHI:   | "InChI=1S/C31H42N6O3.ClH/c1-30(2,32)28(39)34-26(18-23-20-33-25-15-10-9-14-24(23)25)27(38)37-17-11-16-31(21-37,29(40)36(5)35(3)4)19-22-12-7-6-8-13-22;/h6-10,12-15,20,26,33H,11,16-19,21,32H2,1-5H3,(H,34,39);1H/t26-,31-;/m1./s1" |
| Standard InCHIKey:   | VFYAEUWJFGTGGO-GHTUPXNNSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD7618Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 546.33 |
| ALogP   | -1.818 |
| MLogP   | 3.88 |
| XLogP   | 4.184 |
| HDA   | 9 |
| HBD   | 3 |
| Rotatable Bonds   | 18 |
| TPSA   | 118.26 |
| RO5 Violation   | 1 |