Drug Information| Drug ID:   | NPD7451 |
| Drug Name:   | frakefamide |
| Molecular Formula:   | C30H34FN5O5 |
| Canonical SMILES:   | Fc1ccc(cc1)C[C@@H](C(=N[C@H](C(=N)O)Cc1ccccc1)O)N=C([C@H](N=C([C@H](Cc1ccc(cc1)O)N)O)C)O |
| Standard InCHI:   | "InChI=1S/C30H34FN5O5/c1-18(34-29(40)24(32)15-20-9-13-23(37)14-10-20)28(39)36-26(17-21-7-11-22(31)12-8-21)30(41)35-25(27(33)38)16-19-5-3-2-4-6-19/h2-14,18,24-26,37H,15-17,32H2,1H3,(H2,33,38)(H,34,40)(H,35,41)(H,36,39)/t18-,24+,25+,26+/m1/s1" |
| Standard InCHIKey:   | GTPHQORJKFJIRB-JTQLPTLWSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7451Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5763 | NPC82963 |
| Remote Similarity | 0.5254 | NPC621 |
| Remote Similarity | 0.5172 | NPC267237 |
| Remote Similarity | 0.5085 | NPC38458 |
| Remote Similarity | 0.5085 | NPC311737 |
| Molecular Weight   | 563.25 |
| ALogP   | -1.4468 |
| MLogP   | 3.55 |
| XLogP   | 6.063 |
| HDA   | 9 |
| HBD   | 7 |
| Rotatable Bonds   | 21 |
| TPSA   | 188.1 |
| RO5 Violation   | 3 |