Drug Information| Drug ID: | NPD7359 |
| Drug Name: | Triclofos Sodium |
| Molecular Formula: | C2H4Cl3O4P.Na |
| Canonical SMILES: | ClC(COP(=O)(O)[O-])(Cl)Cl.[Na+] |
| Standard InCHI: | InChI=1S/C2H4Cl3O4P.Na/c3-2(4,5)1-9-10(6,7)8;/h1H2,(H2,6,7,8);/q;+1/p-1 |
| Standard InCHIKey: | WFKJEZKHPGDCRK-UHFFFAOYSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD7359Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7586 | NPC290971 |
| Remote Similarity | 0.6207 | NPC317545 |
| Remote Similarity | 0.6154 | NPC254757 |
| Remote Similarity | 0.5862 | NPC321100 |
| Remote Similarity | 0.5862 | NPC314978 |