Drug Information| Drug ID:   | NPD723 |
| Drug Name:   | Censavudine; OBP-601 |
| Molecular Formula:   | C12H12N2O4 |
| Canonical SMILES:   | OC[C@]1(C#C)C=C[C@@H](O1)n1cc(C)c(nc1=O)O |
| Standard InCHI:   | "InChI=1S/C12H12N2O4/c1-3-12(7-15)5-4-9(18-12)14-6-8(2)10(16)13-11(14)17/h1,4-6,9,15H,7H2,2H3,(H,13,16,17)/t9-,12+/m1/s1" |
| Standard InCHIKey:   | OSYWBJSVKUFFSU-SKDRFNHKSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD723Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 248.08 |
| ALogP   | 0.0262 |
| MLogP   | 2.12 |
| XLogP   | -0.262 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 5 |
| TPSA   | 82.36 |
| RO5 Violation   | 0 |