NPASS drugs

Drug Information

Drug ID:	NPD7153
Drug Name:	nuvanil
Molecular Formula:	C28H48N2O3
Canonical SMILES:	CCCCCCCC/C=CCCCCCCCC(=NCc1ccc(c(c1)OC)OCCN)O
Standard InCHI:	"InChI=1S/C28H48N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28(31)30-24-25-19-20-26(33-22-21-29)27(23-25)32-2/h10-11,19-20,23H,3-9,12-18,21-22,24,29H2,1-2H3,(H,30,31)/b11-10-"
Standard InCHIKey:	BTKHXNIRAYKGMN-KHPPLWFESA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD7153

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	92077
0.1-0.2	113496
0.2-0.3	5966
0.3-0.4	154
0.4-0.5	19
0.5-0.6	22
0.6-0.7	4
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7627	NPC483621
Intermediate Similarity	0.7049	NPC483622
Remote Similarity	0.6964	NPC74427
Remote Similarity	0.6452	NPC53596
Remote Similarity	0.6154	NPC6854
Remote Similarity	0.6154	NPC289330
Remote Similarity	0.5882	NPC82196
Remote Similarity	0.5758	NPC483619
Remote Similarity	0.5672	NPC160120
Remote Similarity	0.55	NPC74936
Remote Similarity	0.55	NPC159178
Remote Similarity	0.5484	NPC471308
Remote Similarity	0.5484	NPC483618
Remote Similarity	0.5484	NPC17388
Remote Similarity	0.5429	NPC167757
Remote Similarity	0.5286	NPC48907
Remote Similarity	0.5286	NPC259193
Remote Similarity	0.5286	NPC121255
Remote Similarity	0.5238	NPC209764
Remote Similarity	0.5231	NPC285078
Remote Similarity	0.5231	NPC130595
Remote Similarity	0.5231	NPC93882
Remote Similarity	0.5231	NPC255540
Remote Similarity	0.5231	NPC298277
Remote Similarity	0.5147	NPC483620
Remote Similarity	0.5143	NPC308885
Remote Similarity	0.5143	NPC255550
Remote Similarity	0.507	NPC190635

Drug Structure

NPD7153 OpenBabel08211711362D 36 36 0 0 0 0 0 0 0 0999 V2000 2.5981 -13.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -14.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -13.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -12.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -12.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -11.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -9.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -9.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -8.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 4.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 4.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 4.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 32 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 2 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 28 1 0 0 0 0 19 20 2 0 0 0 0 19 25 1 0 0 0 0 20 26 1 0 0 0 0 21 22 1 0 0 0 0 21 29 1 0 0 0 0 22 33 1 0 0 0 0 23 25 2 0 0 0 0 23 27 1 0 0 0 0 24 25 1 0 0 0 0 24 30 1 0 0 0 0 26 27 2 0 0 0 0 26 33 1 0 0 0 0 27 32 1 0 0 0 0 28 30 2 3 0 0 0 28 31 1 0 0 0 0 29 34 1 0 0 0 0 29 35 1 0 0 0 0 31 36 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB001924
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	460.37
ALogP	-3.3297
MLogP	3.99
XLogP	9.011
HDA	3
HBD	2
Rotatable Bonds	25
TPSA	77.07
RO5 Violation	2