Drug Information| Drug ID:   | NPD7025 |
| Drug Name:   | lurtotecan |
| Molecular Formula:   | C28H30N4O6 |
| Canonical SMILES:   | CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4cc5OCCOc5cc4c(c3Cn1c2=O)CN1CCN(CC1)C |
| Standard InCHI:   | "InChI=1S/C28H30N4O6/c1-3-28(35)20-11-22-25-18(14-32(22)26(33)19(20)15-38-27(28)34)17(13-31-6-4-30(2)5-7-31)16-10-23-24(12-21(16)29-25)37-9-8-36-23/h10-12,35H,3-9,13-15H2,1-2H3/t28-/m0/s1" |
| Standard InCHIKey:   | RVFGKBWWUQOIOU-NDEPHWFRSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD7025Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5354 | NPC276661 |
| Remote Similarity | 0.5354 | NPC599818 |
| Remote Similarity | 0.5258 | NPC106338 |
| Remote Similarity | 0.5258 | NPC303320 |
| Remote Similarity | 0.5258 | NPC541875 |
| Remote Similarity | 0.5258 | NPC608071 |
| Remote Similarity | 0.5152 | NPC128115 |
| Remote Similarity | 0.5152 | NPC42856 |
| Remote Similarity | 0.5088 | NPC197381 |
| Remote Similarity | 0.5051 | NPC192674 |
| Remote Similarity | 0.5051 | NPC599867 |
| TTD   | DIB000131; DIB000021 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 60956 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 518.22 |
| ALogP   | -1.6853 |
| MLogP   | 3.44 |
| XLogP   | 0.009 |
| HDA   | 8 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 104.67 |
| RO5 Violation   | 0 |