Drug Information| Drug ID:   | NPD6997 |
| Drug Name:   | Naltalimide |
| Molecular Formula:   | C28H28N2O5 |
| Canonical SMILES:   | Oc1ccc2c3c1OC1[C@@]43CCN(C(C2)[C@]4(O)CC[C@H]1N1C(=O)c2c(C1=O)cccc2)CC1CC1 |
| Standard InCHI:   | "InChI=1S/C28H28N2O5/c31-20-8-7-16-13-21-28(34)10-9-19(30-25(32)17-3-1-2-4-18(17)26(30)33)24-27(28,22(16)23(20)35-24)11-12-29(21)14-15-5-6-15/h1-4,7-8,15,19,21,24,31,34H,5-6,9-14H2/t19-,21?,24?,27+,28-/m1/s1" |
| Standard InCHIKey:   | DHAITNWJDOSRBU-RCSSWNHXSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6997Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6875 | NPC611959 |
| Remote Similarity | 0.5714 | NPC254045 |
| Remote Similarity | 0.5714 | NPC201055 |
| Remote Similarity | 0.5714 | NPC265000 |
| Remote Similarity | 0.5714 | NPC64576 |
| Remote Similarity | 0.5714 | NPC151470 |
| Remote Similarity | 0.5714 | NPC603205 |
| Remote Similarity | 0.5714 | NPC603486 |
| Remote Similarity | 0.5714 | NPC611632 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 472.2 |
| ALogP   | -2.1118 |
| MLogP   | 3.77 |
| XLogP   | 2.951 |
| HDA   | 5 |
| HBD   | 2 |
| Rotatable Bonds   | 5 |
| TPSA   | 90.31 |
| RO5 Violation   | 0 |