Drug Information| Drug ID:   | NPD6935 |
| Drug Name:   | Elacytarabine |
| Molecular Formula:   | C27H45N3O6 |
| Canonical SMILES:   | CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1ccc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C27H45N3O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(31)35-20-21-24(32)25(33)26(36-21)30-19-18-22(28)29-27(30)34/h9-10,18-19,21,24-26,32-33H,2-8,11-17,20H2,1H3,(H2,28,29,34)/b10-9+/t21-,24-,25+,26-/m1/s1" |
| Standard InCHIKey:   | FLFGNMFWNBOBGE-FNNZEKJRSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6935Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6176 | NPC226769 |
| Remote Similarity | 0.5676 | NPC120887 |
| Remote Similarity | 0.5455 | NPC328779 |
| Remote Similarity | 0.5455 | NPC240517 |
| Remote Similarity | 0.5455 | NPC129 |
| Remote Similarity | 0.5309 | NPC126704 |
| Remote Similarity | 0.5224 | NPC62927 |
| Remote Similarity | 0.5059 | NPC328914 |
| Remote Similarity | 0.5054 | NPC322779 |
| Remote Similarity | 0.5054 | NPC326455 |
| Remote Similarity | 0.5054 | NPC323628 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 507.33 |
| ALogP   | -4.122 |
| MLogP   | 3.44 |
| XLogP   | 7.977 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 23 |
| TPSA   | 135.67 |
| RO5 Violation   | 2 |