Drug Information| Drug ID:   | NPD6901 |
| Drug Name:   | Cilengitide |
| Molecular Formula:   | C27H40N8O7 |
| Canonical SMILES:   | OC(=O)C[C@@H]1N=C(O)CN=C(O)[C@H](CCCNC(=N)N)N=C([C@@H](N(C(=O)[C@H](N=C1O)Cc1ccccc1)C)C(C)C)O |
| Standard InCHI:   | "InChI=1S/C27H40N8O7/c1-15(2)22-25(41)33-17(10-7-11-30-27(28)29)23(39)31-14-20(36)32-18(13-21(37)38)24(40)34-19(26(42)35(22)3)12-16-8-5-4-6-9-16/h4-6,8-9,15,17-19,22H,7,10-14H2,1-3H3,(H,31,39)(H,32,36)(H,33,41)(H,34,40)(H,37,38)(H4,28,29,30)/t17-,18-,19+,22-/m0/s1" |
| Standard InCHIKey:   | AMLYAMJWYAIXIA-VWNVYAMZSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6901Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 588.3 |
| ALogP   | -2.2927 |
| MLogP   | 2.78 |
| XLogP   | 1.655 |
| HDA   | 15 |
| HBD   | 8 |
| Rotatable Bonds   | 19 |
| TPSA   | 249.87 |
| RO5 Violation   | 2 |