Drug Information| Drug ID:   | NPD6867 |
| Drug Name:   | |
| Molecular Formula:   | C27H35N5O7S |
| Canonical SMILES:   | CSCC[C@@H](C(=O)O)N=C([C@@H](N=C(CN=C(CN=C([C@H](Cc1ccc(cc1)O)N)O)O)O)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C27H35N5O7S/c1-40-12-11-21(27(38)39)32-26(37)22(14-17-5-3-2-4-6-17)31-24(35)16-29-23(34)15-30-25(36)20(28)13-18-7-9-19(33)10-8-18/h2-10,20-22,33H,11-16,28H2,1H3,(H,29,34)(H,30,36)(H,31,35)(H,32,37)(H,38,39)/t20-,21-,22-/m0/s1" |
| Standard InCHIKey:   | YFGBQHOOROIVKG-FKBYEOEOSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD6867Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 573.23 |
| ALogP   | -2.11 |
| MLogP   | 3 |
| XLogP   | 0.903 |
| HDA   | 11 |
| HBD   | 7 |
| Rotatable Bonds   | 24 |
| TPSA   | 239.21 |
| RO5 Violation   | 3 |