NPASS drugs

Drug Information

Drug ID:	NPD685
Drug Name:	Ranelic Acid
Molecular Formula:	C12H10N2O8S
Canonical SMILES:	N#Cc1c(sc(c1CC(=O)O)C(=O)O)N(CC(=O)O)CC(=O)O
Standard InCHI:	InChI=1S/C12H10N2O8S/c13-2-6-5(1-7(15)16)10(12(21)22)23-11(6)14(3-8(17)18)4-9(19)20/h1,3-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)
Standard InCHIKey:	DJSXNILVACEBLP-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD685

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	162
0.1-0.2	2721
0.2-0.3	10623
0.3-0.4	13974
0.4-0.5	3255
0.5-0.6	152
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6242	NPC23908
Remote Similarity	0.6076	NPC314098
Remote Similarity	0.6037	NPC43477
Remote Similarity	0.5818	NPC315224
Remote Similarity	0.5801	NPC302647
Remote Similarity	0.5765	NPC478039
Remote Similarity	0.5747	NPC312860
Remote Similarity	0.5737	NPC75544
Remote Similarity	0.5629	NPC238412
Remote Similarity	0.56	NPC143325

Drug Structure

NPD685 OpenBabel08201723412D 27 27 0 0 0 0 0 0 0 0999 V2000 2.5691 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8968 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2733 -1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1280 -2.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6180 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 -0.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3122 -0.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6800 -0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4598 -3.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 0.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3090 -0.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 1.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4846 -2.5691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.2788 -1.7601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.1043 -1.3383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2633 -0.0511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0922 0.0670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6745 -0.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4543 -3.3781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0531 -4.3962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6750 2.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0570 2.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 5.0064 -0.7202 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0813 0.2761 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6409 -5.2052 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0570 3.0878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 1 0 0 0 0 1 7 1 0 0 0 0 2 6 1 0 0 0 0 2 13 3 0 0 0 0 3 8 1 0 0 0 0 3 14 1 0 0 0 0 4 9 1 0 0 0 0 4 14 1 0 0 0 0 5 6 1 0 0 0 0 5 10 2 0 0 0 0 6 11 2 0 0 0 0 7 15 2 0 0 0 0 7 16 1 0 0 0 0 8 17 2 0 0 0 0 8 18 1 0 0 0 0 9 19 2 0 0 0 0 9 20 1 0 0 0 0 10 12 1 0 0 0 0 10 23 1 0 0 0 0 11 14 1 0 0 0 0 11 23 1 0 0 0 0 12 21 2 0 0 0 0 12 22 1 0 0 0 0 16 24 1 0 0 0 0 18 25 1 0 0 0 0 20 26 1 0 0 0 0 22 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	342.02
ALogP	-0.6895
MLogP	1.57
XLogP	-1.704
HDA	10
HBD	4
Rotatable Bonds	12
TPSA	204.47
RO5 Violation	0