Drug Information| Drug ID:   | NPD6664 |
| Drug Name:   | Cabergoline |
| Molecular Formula:   | C26H37N5O2 |
| Canonical SMILES:   | C=CCN1C[C@@H](C[C@H]2[C@H]1Cc1c[nH]c3c1c2ccc3)C(=O)N(C(=NCC)O)CCCN(C)C |
| Standard InCHI:   | "InChI=1S/C26H37N5O2/c1-5-11-30-17-19(25(32)31(26(33)27-6-2)13-8-12-29(3)4)14-21-20-9-7-10-22-24(20)18(16-28-22)15-23(21)30/h5,7,9-10,16,19,21,23,28H,1,6,8,11-15,17H2,2-4H3,(H,27,33)/t19-,21-,23-/m1/s1" |
| Standard InCHIKey:   | KORNTPPJEAJQIU-KJXAQDMKSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6664Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5375 | NPC56765 |
| Remote Similarity | 0.5375 | NPC175190 |
| Remote Similarity | 0.5375 | NPC506981 |
| Remote Similarity | 0.5375 | NPC602380 |
| Remote Similarity | 0.5119 | NPC586903 |
| Remote Similarity | 0.5119 | NPC603365 |
| Molecular Weight   | 451.29 |
| ALogP   | -0.1694 |
| MLogP   | 3.55 |
| XLogP   | 2.765 |
| HDA   | 7 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 75.17 |
| RO5 Violation   | 0 |