Drug Information| Drug ID:   | NPD6636 |
| Drug Name:   | "Fenretinide (Soft Gel Capsule, Amd), Revision Therapeutics" |
| Molecular Formula:   | C26H33NO2 |
| Canonical SMILES:   | O=C(Nc1ccc(cc1)O)/C=C(/C=C/C=C(/C=C/C1=C(C)CCCC1(C)C)C)C |
| Standard InCHI:   | "InChI=1S/C26H33NO2/c1-19(11-16-24-21(3)10-7-17-26(24,4)5)8-6-9-20(2)18-25(29)27-22-12-14-23(28)15-13-22/h6,8-9,11-16,18,28H,7,10,17H2,1-5H3,(H,27,29)/b9-6+,16-11+,19-8+,20-18+" |
| Standard InCHIKey:   | AKJHMTWEGVYYSE-FXILSDISSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6636Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5091 | NPC22019 |
| Remote Similarity | 0.5091 | NPC281986 |
| Remote Similarity | 0.5091 | NPC328240 |
| Remote Similarity | 0.5091 | NPC608491 |
| Molecular Weight   | 391.25 |
| ALogP   | 3.0318 |
| MLogP   | 3.99 |
| XLogP   | 7.413 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 13 |
| TPSA   | 49.33 |
| RO5 Violation   | 1 |