Drug Information| Drug ID:   | NPD6635 |
| Drug Name:   | Abiraterone Acetate |
| Molecular Formula:   | C26H33NO2 |
| Canonical SMILES:   | CC(=O)O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC=C2c2cccnc2)C)C1)C |
| Standard InCHI:   | "InChI=1S/C26H33NO2/c1-17(28)29-20-10-12-25(2)19(15-20)6-7-21-23-9-8-22(18-5-4-14-27-16-18)26(23,3)13-11-24(21)25/h4-6,8,14,16,20-21,23-24H,7,9-13,15H2,1-3H3/t20-,21-,23-,24-,25-,26+/m0/s1" |
| Standard InCHIKey:   | UVIQSJCZCSLXRZ-UBUQANBQSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6635Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5286 | NPC519852 |
| Remote Similarity | 0.5211 | NPC609635 |
| Remote Similarity | 0.5139 | NPC311816 |
| Remote Similarity | 0.5139 | NPC18208 |
| Remote Similarity | 0.5068 | NPC45603 |
| Remote Similarity | 0.5068 | NPC241150 |
| Molecular Weight   | 391.25 |
| ALogP   | 0.8621 |
| MLogP   | 3.99 |
| XLogP   | 6.532 |
| HDA   | 3 |
| HBD   | 0 |
| Rotatable Bonds   | 6 |
| TPSA   | 39.19 |
| RO5 Violation   | 1 |