NPASS drugs

Drug Information

Drug ID:	NPD6417
Drug Name:
Molecular Formula:	C25H40N7O19P3S2
Canonical SMILES:	OC(=O)CSCC(=O)SCCN=C(CCN=C([C@@H](C(COP(=O)(OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1OP(=O)(O)O)O)n1cnc2c1ncnc2N)O)O)(C)C)O)O)O
Standard InCHI:	"InChI=1S/C25H40N7O19P3S2/c1-25(2,20(38)23(39)28-4-3-14(33)27-5-6-56-16(36)9-55-8-15(34)35)10-48-54(45,46)51-53(43,44)47-7-13-19(50-52(40,41)42)18(37)24(49-13)32-12-31-17-21(26)29-11-30-22(17)32/h11-13,18-20,24,37-38H,3-10H2,1-2H3,(H,27,33)(H,28,39)(H,34,35)(H,43,44)(H,45,46)(H2,26,29,30)(H2,40,41,42)/t13-,18-,19-,20+,24-/m1/s1"
Standard InCHIKey:	GKSSRSUPHZUOQO-ITIYDSSPSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD6417

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	105417
0.1-0.2	105397
0.2-0.3	400
0.3-0.4	200
0.4-0.5	127
0.5-0.6	155
0.6-0.7	40
0.7-0.8	3
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.844	NPC16850
Intermediate Similarity	0.7658	NPC189261
Intermediate Similarity	0.7623	NPC66607
Intermediate Similarity	0.7266	NPC542999
Remote Similarity	0.6308	NPC322579
Remote Similarity	0.6279	NPC494445
Remote Similarity	0.626	NPC329479
Remote Similarity	0.626	NPC521662
Remote Similarity	0.624	NPC318252
Remote Similarity	0.6231	NPC328003
Remote Similarity	0.6231	NPC314829
Remote Similarity	0.6231	NPC317629
Remote Similarity	0.6231	NPC499631
Remote Similarity	0.6212	NPC507916
Remote Similarity	0.6202	NPC327175
Remote Similarity	0.6202	NPC315052
Remote Similarity	0.6202	NPC500106
Remote Similarity	0.616	NPC315373
Remote Similarity	0.6142	NPC325273
Remote Similarity	0.6142	NPC319681
Remote Similarity	0.6136	NPC322008
Remote Similarity	0.6136	NPC326390
Remote Similarity	0.6136	NPC325674
Remote Similarity	0.6129	NPC553227
Remote Similarity	0.6094	NPC321985
Remote Similarity	0.6063	NPC322388
Remote Similarity	0.6063	NPC323290
Remote Similarity	0.6063	NPC325198
Remote Similarity	0.6063	NPC326242
Remote Similarity	0.6063	NPC530178
Remote Similarity	0.605	NPC218635
Remote Similarity	0.6032	NPC315287
Remote Similarity	0.6016	NPC327435
Remote Similarity	0.6016	NPC318550
Remote Similarity	0.6016	NPC516916
Remote Similarity	0.6016	NPC579680
Remote Similarity	0.6016	NPC611977
Remote Similarity	0.6	NPC328838
Remote Similarity	0.6	NPC327690
Remote Similarity	0.6	NPC321678
Remote Similarity	0.6	NPC317510
Remote Similarity	0.6	NPC329452
Remote Similarity	0.6	NPC322738
Remote Similarity	0.6	NPC525718
Remote Similarity	0.5984	NPC320431
Remote Similarity	0.597	NPC500471
Remote Similarity	0.5969	NPC328753
Remote Similarity	0.5954	NPC324529
Remote Similarity	0.5954	NPC319732
Remote Similarity	0.5954	NPC320536
Remote Similarity	0.5938	NPC324302
Remote Similarity	0.5938	NPC549585
Remote Similarity	0.5923	NPC321612
Remote Similarity	0.5923	NPC325588
Remote Similarity	0.5923	NPC325636
Remote Similarity	0.5909	NPC325854
Remote Similarity	0.5909	NPC326899
Remote Similarity	0.5891	NPC327561
Remote Similarity	0.5891	NPC321987
Remote Similarity	0.5878	NPC320872
Remote Similarity	0.5878	NPC326209
Remote Similarity	0.5878	NPC328096
Remote Similarity	0.5878	NPC327480
Remote Similarity	0.5878	NPC325206
Remote Similarity	0.5878	NPC319885
Remote Similarity	0.5878	NPC322749
Remote Similarity	0.5878	NPC325119
Remote Similarity	0.5878	NPC325907
Remote Similarity	0.5878	NPC322724
Remote Similarity	0.5878	NPC546561
Remote Similarity	0.5873	NPC320687
Remote Similarity	0.5833	NPC316505
Remote Similarity	0.5833	NPC328624
Remote Similarity	0.5821	NPC327453
Remote Similarity	0.5802	NPC329389
Remote Similarity	0.5789	NPC322711
Remote Similarity	0.5789	NPC317883
Remote Similarity	0.5789	NPC329412
Remote Similarity	0.5789	NPC327681
Remote Similarity	0.5789	NPC322432
Remote Similarity	0.5789	NPC321903
Remote Similarity	0.5789	NPC324609
Remote Similarity	0.5789	NPC327417
Remote Similarity	0.5789	NPC325894
Remote Similarity	0.5789	NPC322266
Remote Similarity	0.5789	NPC326379
Remote Similarity	0.5789	NPC325185
Remote Similarity	0.5778	NPC322479
Remote Similarity	0.5778	NPC322770
Remote Similarity	0.5778	NPC326682
Remote Similarity	0.5778	NPC496022
Remote Similarity	0.5778	NPC575083
Remote Similarity	0.5758	NPC322656
Remote Similarity	0.5746	NPC328226
Remote Similarity	0.5746	NPC326746
Remote Similarity	0.5746	NPC319724
Remote Similarity	0.5746	NPC321685
Remote Similarity	0.5746	NPC317387
Remote Similarity	0.5746	NPC323383
Remote Similarity	0.5746	NPC317252
Remote Similarity	0.5746	NPC322614
Remote Similarity	0.5746	NPC322149
Remote Similarity	0.5746	NPC318932
Remote Similarity	0.5746	NPC327835
Remote Similarity	0.5746	NPC538465
Remote Similarity	0.5735	NPC325955
Remote Similarity	0.5714	NPC525895
Remote Similarity	0.5704	NPC329020
Remote Similarity	0.5704	NPC319366
Remote Similarity	0.5704	NPC326954
Remote Similarity	0.5704	NPC321287
Remote Similarity	0.5704	NPC316567
Remote Similarity	0.5704	NPC320913
Remote Similarity	0.5704	NPC316683
Remote Similarity	0.5662	NPC325848
Remote Similarity	0.5662	NPC318508
Remote Similarity	0.5662	NPC326303
Remote Similarity	0.5662	NPC319303
Remote Similarity	0.5662	NPC323425
Remote Similarity	0.5662	NPC323022
Remote Similarity	0.5662	NPC328537
Remote Similarity	0.5652	NPC327882
Remote Similarity	0.5652	NPC503397
Remote Similarity	0.5652	NPC539589
Remote Similarity	0.5643	NPC169347
Remote Similarity	0.563	NPC324687
Remote Similarity	0.562	NPC326676
Remote Similarity	0.562	NPC326689
Remote Similarity	0.562	NPC329340
Remote Similarity	0.562	NPC318693
Remote Similarity	0.562	NPC321784
Remote Similarity	0.562	NPC329035
Remote Similarity	0.562	NPC328355
Remote Similarity	0.562	NPC327135
Remote Similarity	0.562	NPC537655
Remote Similarity	0.5588	NPC316705
Remote Similarity	0.558	NPC318147
Remote Similarity	0.558	NPC321080
Remote Similarity	0.558	NPC322582
Remote Similarity	0.558	NPC322134
Remote Similarity	0.558	NPC329407
Remote Similarity	0.558	NPC320762
Remote Similarity	0.5547	NPC318836
Remote Similarity	0.5547	NPC548787
Remote Similarity	0.554	NPC323988
Remote Similarity	0.554	NPC319078
Remote Similarity	0.554	NPC563852
Remote Similarity	0.5532	NPC503693
Remote Similarity	0.5532	NPC539379
Remote Similarity	0.5532	NPC601970
Remote Similarity	0.5515	NPC321764
Remote Similarity	0.5515	NPC558555
Remote Similarity	0.5493	NPC318671
Remote Similarity	0.5473	NPC577606
Remote Similarity	0.5468	NPC321932
Remote Similarity	0.5461	NPC328505
Remote Similarity	0.5436	NPC318008
Remote Similarity	0.5436	NPC318737
Remote Similarity	0.5405	NPC323654
Remote Similarity	0.5385	NPC493860
Remote Similarity	0.5385	NPC570961
Remote Similarity	0.5374	NPC316778
Remote Similarity	0.5374	NPC569358
Remote Similarity	0.5369	NPC327255
Remote Similarity	0.5357	NPC325191
Remote Similarity	0.5347	NPC326710
Remote Similarity	0.5329	NPC527445
Remote Similarity	0.5315	NPC328365
Remote Similarity	0.531	NPC596725
Remote Similarity	0.5304	NPC319652
Remote Similarity	0.5304	NPC525974
Remote Similarity	0.5298	NPC324483
Remote Similarity	0.5298	NPC328575
Remote Similarity	0.5294	NPC512977
Remote Similarity	0.5274	NPC328684
Remote Similarity	0.5274	NPC324555
Remote Similarity	0.5274	NPC531838
Remote Similarity	0.5274	NPC593780
Remote Similarity	0.527	NPC534099
Remote Similarity	0.5238	NPC323901
Remote Similarity	0.5232	NPC329323
Remote Similarity	0.5229	NPC324567
Remote Similarity	0.5226	NPC577583
Remote Similarity	0.5208	NPC320699
Remote Similarity	0.5203	NPC327711
Remote Similarity	0.5203	NPC321274
Remote Similarity	0.5203	NPC327618
Remote Similarity	0.5168	NPC328990
Remote Similarity	0.5168	NPC531866
Remote Similarity	0.5163	NPC324508
Remote Similarity	0.5161	NPC323640
Remote Similarity	0.5138	NPC164952
Remote Similarity	0.5138	NPC505783
Remote Similarity	0.5133	NPC328222
Remote Similarity	0.513	NPC317202
Remote Similarity	0.5099	NPC527496
Remote Similarity	0.5096	NPC317353
Remote Similarity	0.5068	NPC323384
Remote Similarity	0.5064	NPC320578

Drug Structure

NPD6417 OpenBabel08211709092D 67 69 0 0 1 0 0 0 0 0999 V2000 -3.9726 6.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2294 5.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3379 5.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6688 5.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6033 6.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9123 7.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1151 1.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1702 11.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5303 9.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0434 6.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6428 5.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4820 1.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0933 1.7796 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3161 5.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4792 12.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1994 8.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8184 3.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4945 0.9706 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5000 0.8660 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3306 7.4207 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2251 4.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8239 3.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3087 7.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7024 1.9487 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0215 6.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2197 4.4562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.6251 6.3502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.9778 6.8854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6374 5.1607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.2361 4.1426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.2251 2.5246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6160 2.3554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.9852 4.6560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8101 12.7997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4574 12.2645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1776 8.8761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1637 0.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6614 8.1638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6177 8.5797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3800 2.1683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1502 3.3544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2219 4.8948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5483 6.0809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1939 2.9385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7344 5.3107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8364 2.4487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9641 4.1246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 -1.1720 3.1465 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 -0.7562 5.1027 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 -8.8393 10.3624 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -8.8904 7.7171 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 6.6264 5.3697 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8075 3.6472 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9634 4.8639 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7664 13.2155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1418 0.4353 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9704 9.1149 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9486 9.3228 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3310 1.8593 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5309 3.9438 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 25 1 0 0 0 0 2 25 1 0 0 0 0 3 4 1 0 0 0 0 3 14 1 0 0 0 0 4 28 1 0 0 0 0 5 6 1 0 0 0 0 5 27 1 0 0 0 0 6 56 1 0 0 0 0 7 47 1 0 0 0 0 8 15 1 0 0 0 0 8 55 1 0 0 0 0 9 16 1 0 0 0 0 9 55 1 0 0 0 0 10 25 1 0 0 0 0 10 48 1 0 0 0 0 11 29 2 0 0 0 0 11 30 1 0 0 0 0 12 31 2 0 0 0 0 12 32 1 0 0 0 0 13 7 1 1 0 0 0 13 19 1 0 0 0 0 13 49 1 0 0 0 0 14 27 2 3 0 0 0 14 33 1 0 0 0 0 15 34 2 0 0 0 0 15 35 1 0 0 0 0 16 36 2 0 0 0 0 16 56 1 0 0 0 0 17 21 2 0 0 0 0 17 22 1 0 0 0 0 17 31 1 0 0 0 0 18 19 1 0 0 0 0 18 24 1 0 0 0 0 18 37 1 6 0 0 0 19 50 1 6 0 0 0 20 23 1 6 0 0 0 20 25 1 0 0 0 0 20 38 1 0 0 0 0 21 26 1 0 0 0 0 21 29 1 0 0 0 0 22 30 2 0 0 0 0 22 32 1 0 0 0 0 23 28 2 3 0 0 0 23 39 1 0 0 0 0 24 32 1 1 0 0 0 24 49 1 0 0 0 0 26 57 1 0 0 0 0 26 58 1 0 0 0 0 33 59 1 0 0 0 0 35 60 1 0 0 0 0 37 61 1 0 0 0 0 38 62 1 0 0 0 0 39 63 1 0 0 0 0 40 52 1 0 0 0 0 40 64 1 0 0 0 0 41 52 1 0 0 0 0 41 65 1 0 0 0 0 42 52 2 0 0 0 0 43 53 1 0 0 0 0 43 66 1 0 0 0 0 44 53 2 0 0 0 0 45 54 1 0 0 0 0 45 67 1 0 0 0 0 46 54 2 0 0 0 0 47 53 1 0 0 0 0 48 54 1 0 0 0 0 50 52 1 0 0 0 0 51 53 1 0 0 0 0 51 54 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNCL001621
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	24768536
ChEBI
CAS Number

Drug Properties

Molecular Weight	899.1
ALogP	-2.1011
MLogP	0.8
XLogP	-6.002
HDA	26
HBD	10
Rotatable Bonds	36
TPSA	487.94
RO5 Violation	3