Drug Information| Drug ID:   | NPD6353 |
| Drug Name:   | Quinestrol |
| Molecular Formula:   | C25H32O2 |
| Canonical SMILES:   | C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)OC1CCCC1 |
| Standard InCHI:   | "InChI=1S/C25H32O2/c1-3-25(26)15-13-23-22-10-8-17-16-19(27-18-6-4-5-7-18)9-11-20(17)21(22)12-14-24(23,25)2/h1,9,11,16,18,21-23,26H,4-8,10,12-15H2,2H3/t21-,22-,23+,24+,25+/m1/s1" |
| Standard InCHIKey:   | PWZUUYSISTUNDW-VAFBSOEGSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD6353Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DAP001016 |
| DrugBank   | DB04575 |
| ChEMBL   | CHEMBL1201165 |
| IUPHAR/BPS   | 7097 |
| PharmaGKB   | PA164749042 |
| KEGG Drug   | D00576 |
| PubChem CID   | 9046 |
| ChEBI   | 8716 |
| CAS Number   | 152-43-2 |
| Molecular Weight   | 364.24 |
| ALogP   | -0.2921 |
| MLogP   | 3.99 |
| XLogP   | 6.445 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 4 |
| TPSA   | 29.46 |
| RO5 Violation   | 1 |