Drug Information| Drug ID: | NPD62 |
| Drug Name: | Magnesium Levulinate |
| Molecular Formula: | 2C5H8O3.Mg |
| Canonical SMILES: | [O-]C(=O)CCC(=O)C.[O-]C(=O)CCC(=O)C.[Mg+2] |
| Standard InCHI: | InChI=1S/2C5H8O3.Mg/c2*1-4(6)2-3-5(7)8;/h2*2-3H2,1H3,(H,7,8);/q;;+2/p-2 |
| Standard InCHIKey: | RECCGACJWKEPOU-UHFFFAOYSA-L |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD62Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7