Drug Information| Drug ID: | NPD608 |
| Drug Name: | Amobarbital Sodium |
| Molecular Formula: | C11H18N2O3.Na |
| Canonical SMILES: | CCC1(CCC(C)C)C(=NC(=O)N=C1O)[O-].[Na+] |
| Standard InCHI: | InChI=1S/C11H18N2O3.Na/c1-4-11(6-5-7(2)3)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;+1/p-1 |
| Standard InCHIKey: | BNHGKKNINBGEQL-UHFFFAOYSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD608Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7966 | NPC21848 |
| Intermediate Similarity | 0.7966 | NPC124849 |
| Remote Similarity | 0.6607 | NPC180402 |
| Remote Similarity | 0.6607 | NPC87359 |
| Remote Similarity | 0.6441 | NPC137327 |
| Remote Similarity | 0.5769 | NPC61665 |
| Remote Similarity | 0.5769 | NPC328441 |
| Remote Similarity | 0.5738 | NPC471131 |
| Remote Similarity | 0.5667 | NPC21142 |
| Remote Similarity | 0.5667 | NPC80350 |