Drug Information| Drug ID:   | NPD597 |
| Drug Name:   | Isoproterenol Hydrochloride |
| Molecular Formula:   | C11H17NO3.ClH |
| Canonical SMILES:   | CC(NCC(c1ccc(c(c1)O)O)O)C.Cl |
| Standard InCHI:   | "InChI=1S/C11H17NO3.ClH/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8;/h3-5,7,11-15H,6H2,1-2H3;1H" |
| Standard InCHIKey:   | IROWCYIEJAOFOW-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD597Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9688 | NPC483291 |
| High Similarity | 0.9688 | NPC611998 |
| Intermediate Similarity | 0.7143 | NPC323775 |
| Intermediate Similarity | 0.7143 | NPC236347 |
| Intermediate Similarity | 0.7143 | NPC599888 |
| Intermediate Similarity | 0.7143 | NPC611709 |
| Remote Similarity | 0.6471 | NPC118522 |
| Remote Similarity | 0.6471 | NPC115627 |
| Remote Similarity | 0.6471 | NPC169207 |
| Remote Similarity | 0.6471 | NPC599811 |
| Remote Similarity | 0.6471 | NPC602688 |
| Remote Similarity | 0.5111 | NPC130592 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 211.12 |
| ALogP   | -1.7879 |
| MLogP   | 2.23 |
| XLogP   | 0.813 |
| HDA   | 2 |
| HBD   | 4 |
| Rotatable Bonds   | 9 |
| TPSA   | 72.72 |
| RO5 Violation   | 0 |